C21H22O7 — CID 102444397
(2R,3R)-2-(2,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 102444397) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 102444397 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c2c(c1CC=C(C)C)O[C@H](c1ccc(O)cc1O)[C@@H](O)C2=O |
| InChI | InChI=1S/C21H22O7/c1-10(2)4-6-13-16(27-3)9-15(24)17-18(25)19(26)21(28-20(13)17)12-7-5-11(22)8-14(12)23/h4-5,7-9,19,21-24,26H,6H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | RAKQVVUGKGOCLU-PZJWPPBQSA-N |
| XLogP | 3.00 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|