C22H24O6 — CID 46232310
(3R)-3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 46232310) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (3R)-3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 46232310 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3R)-3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(c(OC)c1CC=C(C)C)C(=O)[C@H](c1ccc(O)cc1O)CO2 |
| InChI | InChI=1S/C22H24O6/c1-12(2)5-7-15-18(26-3)10-19-20(22(15)27-4)21(25)16(11-28-19)14-8-6-13(23)9-17(14)24/h5-6,8-10,16,23-24H,7,11H2,1-4H3/t16-/m0/s1 |
| InChIKey | NBDITDYZVYHVMT-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|