C25H28O6 — CID 26213316
(3R)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 26213316) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is (3R)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 26213316 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (3R)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)[C@H](c1ccc(O)cc1O)CO2 |
| InChI | InChI=1S/C25H28O6/c1-13(2)5-8-17-22(28)18(9-6-14(3)4)25-21(23(17)29)24(30)19(12-31-25)16-10-7-15(26)11-20(16)27/h5-7,10-11,19,26-29H,8-9,12H2,1-4H3/t19-/m0/s1 |
| InChIKey | LYELCCACUCFABR-IBGZPJMESA-N |
| XLogP | 4.89 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|