C21H22O6 — CID 91110852
(3R)-3-[2,3-dihydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-7-hydroxy-2,3-dihydrochromen-4-one (PubChem CID 91110852) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (3R)-3-[2,3-dihydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-7-hydroxy-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-[2,3-dihydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-7-hydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91110852 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (3R)-3-[2,3-dihydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-7-hydroxy-2,3-dihydrochromen-4-one |
| SMILES | COc1c(CC=C(C)C)cc([C@@H]2COc3cc(O)ccc3C2=O)c(O)c1O |
| InChI | InChI=1S/C21H22O6/c1-11(2)4-5-12-8-15(19(24)20(25)21(12)26-3)16-10-27-17-9-13(22)6-7-14(17)18(16)23/h4,6-9,16,22,24-25H,5,10H2,1-3H3/t16-/m0/s1 |
| InChIKey | OHMBRCKLOAPNCF-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|