C22H24O5 — CID 42608075
(2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 42608075) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 42608075 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(OC)c(CC=C(C)C)c3O2)cc1 |
| InChI | InChI=1S/C22H24O5/c1-13(2)5-10-16-20(26-4)12-18(24)21-17(23)11-19(27-22(16)21)14-6-8-15(25-3)9-7-14/h5-9,12,19,24H,10-11H2,1-4H3/t19-/m0/s1 |
| InChIKey | QTEBTSUWUVNMHC-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|