C27H32O6 — CID 71504671
5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 71504671) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 71504671 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3c(O)c(CC=C(C)C)c(OC)c(CC=C(C)C)c3O2)cc1O |
| InChI | InChI=1S/C27H32O6/c1-15(2)7-10-18-25(30)24-21(29)14-23(17-9-12-22(31-5)20(28)13-17)33-27(24)19(26(18)32-6)11-8-16(3)4/h7-9,12-13,23,28,30H,10-11,14H2,1-6H3 |
| InChIKey | ANZHDADPEUSJAH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|