C30H38O7 — CID 9496815
(2S)-5,7-dimethoxy-6,8-bis(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 9496815) has the molecular formula C30H38O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is (2S)-5,7-dimethoxy-6,8-bis(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-5,7-dimethoxy-6,8-bis(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 9496815 |
| Molecular Formula | C30H38O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (2S)-5,7-dimethoxy-6,8-bis(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(OC)c([C@@H]2CC(=O)c3c(OC)c(CC=C(C)C)c(OC)c(CC=C(C)C)c3O2)c(OC)c1 |
| InChI | InChI=1S/C30H38O7/c1-17(2)10-12-20-28(35-8)21(13-11-18(3)4)30-26(29(20)36-9)22(31)16-25(37-30)27-23(33-6)14-19(32-5)15-24(27)34-7/h10-11,14-15,25H,12-13,16H2,1-9H3/t25-/m0/s1 |
| InChIKey | DSEIBCJUAVQQQV-VWLOTQADSA-N |
| XLogP | 6.45 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|