C34H44O6 — CID 25253452
2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxyphenyl]-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 25253452) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxyphenyl]-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxyphenyl]-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 25253452 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxyphenyl]-5,7-dimethoxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(c(OC)c1CC=C(C)C)C(=O)CC(c1ccc(OC)c(OC)c1C/C=C(\C)CCC=C(C)C)O2 |
| InChI | InChI=1S/C34H44O6/c1-21(2)11-10-12-23(5)14-16-25-24(17-18-28(36-6)33(25)38-8)30-19-27(35)32-31(40-30)20-29(37-7)26(34(32)39-9)15-13-22(3)4/h11,13-14,17-18,20,30H,10,12,15-16,19H2,1-9H3/b23-14+ |
| InChIKey | FLVGXZIYZZHIFQ-OEAKJJBVSA-N |
| XLogP | 8.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|