C58H60O6 — CID 25253546
(2S)-2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-bis(phenylmethoxy)phenyl]-6-(3-methylbut-2-enyl)-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-4-one (PubChem CID 25253546) has the molecular formula C58H60O6 and a molecular weight of 853.11 g/mol. Its IUPAC name is (2S)-2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-bis(phenylmethoxy)phenyl]-6-(3-methylbut-2-enyl)-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-bis(phenylmethoxy)phenyl]-6-(3-methylbut-2-enyl)-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 25253546 |
| Molecular Formula | C58H60O6 |
| Molecular Weight | 853.11 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | (2S)-2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-bis(phenylmethoxy)phenyl]-6-(3-methylbut-2-enyl)-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c([C@@H]2CC(=O)c3c(cc(OCc4ccccc4)c(CC=C(C)C)c3OCc3ccccc3)O2)ccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C58H60O6/c1-41(2)19-18-20-43(5)30-32-49-48(33-34-52(60-37-44-21-10-6-11-22-44)57(49)62-39-46-25-14-8-15-26-46)54-35-51(59)56-55(64-54)36-53(61-38-45-23-12-7-13-24-45)50(31-29-42(3)4)58(56)63-40-47-27-16-9-17-28-47/h6-17,19,21-30,33-34,36,54H,18,20,31-32,35,37-40H2,1-5H3/b43-30+/t54-/m0/s1 |
| InChIKey | TXYMYKFTJRXPJE-JHZURCSPSA-N |
| XLogP | 14.45 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.11 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|