C21H21BrO4 — CID 166172034
2-(4-bromophenyl)-7-hydroxy-5-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 166172034) has the molecular formula C21H21BrO4 and a molecular weight of 417.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)-7-hydroxy-5-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(4-bromophenyl)-7-hydroxy-5-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 166172034 |
| Molecular Formula | C21H21BrO4 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-(4-bromophenyl)-7-hydroxy-5-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c(CC=C(C)C)c2c1C(=O)CC(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C21H21BrO4/c1-12(2)4-9-15-16(23)10-19(25-3)20-17(24)11-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,10,18,23H,9,11H2,1-3H3 |
| InChIKey | FGPOCIYMHMCAIS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|