C28H34O5 — CID 155725234
5-hydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-7-propan-2-yloxy-2,3-dihydrochromen-4-one (PubChem CID 155725234) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-7-propan-2-yloxy-2,3-dihydrochromen-4-one.
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-7-propan-2-yloxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 155725234 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-7-propan-2-yloxy-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c(O)c2c(c(CC=C(C)C)c1OC(C)C)OC(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C28H34O5/c1-16(2)7-13-21-26(31)25-23(30)15-24(19-9-11-20(29)12-10-19)33-28(25)22(14-8-17(3)4)27(21)32-18(5)6/h7-12,18,24,29,31H,13-15H2,1-6H3 |
| InChIKey | URKLLZZJGUMOIR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|