C21H22O5 — CID 42608070
5-hydroxy-7-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]-2,3-dihydrochromen-4-one (PubChem CID 42608070) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]-2,3-dihydrochromen-4-one.
| Compound Name | 5-hydroxy-7-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 42608070 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-hydroxy-7-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c2c(c1)OC(c1ccc(OCC=C(C)C)cc1)CC2=O |
| InChI | InChI=1S/C21H22O5/c1-13(2)8-9-25-15-6-4-14(5-7-15)19-12-18(23)21-17(22)10-16(24-3)11-20(21)26-19/h4-8,10-11,19,22H,9,12H2,1-3H3 |
| InChIKey | XTBZRPYCQNETRR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|