C20H19ClO3 — CID 166628671
2-(4-chlorophenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one (PubChem CID 166628671) has the molecular formula C20H19ClO3 and a molecular weight of 342.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 166628671 |
| Molecular Formula | C20H19ClO3 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCOc1ccc2c(c1)OC(c1ccc(Cl)cc1)CC2=O |
| InChI | InChI=1S/C20H19ClO3/c1-13(2)9-10-23-16-7-8-17-18(22)12-19(24-20(17)11-16)14-3-5-15(21)6-4-14/h3-9,11,19H,10,12H2,1-2H3 |
| InChIKey | WXGALQLWURYLIW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|