C21H22O6 — CID 163015493
(2S,3R)-3,5,7-trihydroxy-8-methoxy-6-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 163015493) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2S,3R)-3,5,7-trihydroxy-8-methoxy-6-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3R)-3,5,7-trihydroxy-8-methoxy-6-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163015493 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2S,3R)-3,5,7-trihydroxy-8-methoxy-6-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | COc1c(O)c(CC=C(C)C)c(O)c2c1O[C@@H](c1ccccc1)[C@@H](O)C2=O |
| InChI | InChI=1S/C21H22O6/c1-11(2)9-10-13-15(22)14-17(24)18(25)19(12-7-5-4-6-8-12)27-20(14)21(26-3)16(13)23/h4-9,18-19,22-23,25H,10H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | UQWHUIAIZPLDDZ-OALUTQOASA-N |
| XLogP | 3.29 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|