C17H16O6 — CID 24868417
5,7-dihydroxy-3,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 24868417) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 5,7-dihydroxy-3,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-dihydroxy-3,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 24868417 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5,7-dihydroxy-3,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | COc1c(O)cc(O)c2c1OC(c1ccccc1)C(OC)C2=O |
| InChI | InChI=1S/C17H16O6/c1-21-15-11(19)8-10(18)12-13(20)17(22-2)14(23-16(12)15)9-6-4-3-5-7-9/h3-8,14,17-19H,1-2H3 |
| InChIKey | QBLLTJKVRXHDSK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |