C23H30O4 — CID 163320586
3,5-dihydroxy-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)-3H-2-benzofuran-1-one (PubChem CID 163320586) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3,5-dihydroxy-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)-3H-2-benzofuran-1-one.
| Compound Name | 3,5-dihydroxy-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163320586 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3,5-dihydroxy-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)-3H-2-benzofuran-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)ccc2c1C(O)OC2=O |
| InChI | InChI=1S/C23H30O4/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-18-20(24)14-13-19-21(18)23(26)27-22(19)25/h7,9,11,13-14,23-24,26H,5-6,8,10,12H2,1-4H3 |
| InChIKey | BZRLRBPAGBKZHA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|