C21H30O2 — CID 54371000
2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol (PubChem CID 54371000) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol.
| Compound Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 54371000 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,3-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)cccc1O |
| InChI | InChI=1S/C21H30O2/c1-16(2)8-5-9-17(3)10-6-11-18(4)14-15-19-20(22)12-7-13-21(19)23/h7-8,10,12-14,22-23H,5-6,9,11,15H2,1-4H3 |
| InChIKey | UTEUCOFBKKSQSN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|