C18H25LiO2 — CID 167459395
lithium 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-ethylbenzene-1,3-diol (PubChem CID 167459395) has the molecular formula C18H25LiO2 and a molecular weight of 280.34 g/mol. Its IUPAC name is lithium 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-ethylbenzene-1,3-diol.
| Compound Name | lithium 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167459395 |
| Molecular Formula | C18H25LiO2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | lithium 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-ethylbenzene-1,3-diol |
| SMILES | [CH2-]Cc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1.[Li+] |
| InChI | InChI=1S/C18H25O2.Li/c1-5-15-11-17(19)16(18(20)12-15)10-9-14(4)8-6-7-13(2)3;/h7,9,11-12,19-20H,1,5-6,8,10H2,2-4H3;/q-1;+1/b14-9+; |
| InChIKey | HLPWSRGZTMYVJU-KYIGKLDSSA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|