C23H36O3 — CID 167459407
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-hydroxyethoxy)-5-pentylphenol (PubChem CID 167459407) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-hydroxyethoxy)-5-pentylphenol.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-hydroxyethoxy)-5-pentylphenol |
|---|---|
| PubChem CID | 167459407 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-hydroxyethoxy)-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(OCCO)c1 |
| InChI | InChI=1S/C23H36O3/c1-5-6-7-11-20-16-22(25)21(23(17-20)26-15-14-24)13-12-19(4)10-8-9-18(2)3/h9,12,16-17,24-25H,5-8,10-11,13-15H2,1-4H3/b19-12+ |
| InChIKey | OUUPOPKBZWAVQS-XDHOZWIPSA-N |
| XLogP | 5.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|