C22H35N — CID 146436192
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-5-pentylaniline (PubChem CID 146436192) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-5-pentylaniline.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-5-pentylaniline |
|---|---|
| PubChem CID | 146436192 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methyl-5-pentylaniline |
| SMILES | CCCCCc1cc(C)c(C/C=C(\C)CCC=C(C)C)c(N)c1 |
| InChI | InChI=1S/C22H35N/c1-6-7-8-12-20-15-19(5)21(22(23)16-20)14-13-18(4)11-9-10-17(2)3/h10,13,15-16H,6-9,11-12,14,23H2,1-5H3/b18-13+ |
| InChIKey | RUSXHPPTFJGEKO-QGOAFFKASA-N |
| XLogP | 6.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|