C19H31N — CID 156570794
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentyl-1H-pyrrole (PubChem CID 156570794) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentyl-1H-pyrrole.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentyl-1H-pyrrole |
|---|---|
| PubChem CID | 156570794 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentyl-1H-pyrrole |
| SMILES | CCCCCc1ccc(C/C=C(\C)CCC=C(C)C)[nH]1 |
| InChI | InChI=1S/C19H31N/c1-5-6-7-11-18-14-15-19(20-18)13-12-17(4)10-8-9-16(2)3/h9,12,14-15,20H,5-8,10-11,13H2,1-4H3/b17-12+ |
| InChIKey | KCUAKVBUMMOZDX-SFQUDFHCSA-N |
| XLogP | 5.98 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|