C21H30O3 — CID 74932526
4-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-3-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 74932526) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-3-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-3-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 74932526 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-3-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(CC=C(C)CCC=C(C)C)C(O)=CC(=O)C1=O |
| InChI | InChI=1S/C21H30O3/c1-5-6-7-11-18-17(19(22)14-20(23)21(18)24)13-12-16(4)10-8-9-15(2)3/h9,12,14,22H,5-8,10-11,13H2,1-4H3 |
| InChIKey | JNUWVXFDBXQYBU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|