C22H33NO3 — CID 140815926
3-(3,7-dimethylocta-2,6-dienyl)-4-hydroxy-5-(methylamino)-6-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 140815926) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienyl)-4-hydroxy-5-(methylamino)-6-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienyl)-4-hydroxy-5-(methylamino)-6-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 140815926 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienyl)-4-hydroxy-5-(methylamino)-6-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(NC)C(O)=C(CC=C(C)CCC=C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C22H33NO3/c1-6-7-8-12-17-19(23-5)20(24)18(22(26)21(17)25)14-13-16(4)11-9-10-15(2)3/h10,13,23-24H,6-9,11-12,14H2,1-5H3 |
| InChIKey | JNCRZJQNKRTZNM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|