C29H38O3 — CID 153143290
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-pentyl-5-(2-phenylethyl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 153143290) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-pentyl-5-(2-phenylethyl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-pentyl-5-(2-phenylethyl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 153143290 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-pentyl-5-(2-phenylethyl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(CCc2ccccc2)C(O)=C(C/C=C(\C)CCC=C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C29H38O3/c1-5-6-8-16-24-25(20-18-23-14-9-7-10-15-23)27(30)26(29(32)28(24)31)19-17-22(4)13-11-12-21(2)3/h7,9-10,12,14-15,17,30H,5-6,8,11,13,16,18-20H2,1-4H3/b22-17+ |
| InChIKey | STNHJBSXHNCVRO-OQKWZONESA-N |
| XLogP | 7.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|