C40H54O2 — CID 53363554
2,3-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione (PubChem CID 53363554) has the molecular formula C40H54O2 and a molecular weight of 566.87 g/mol. Its IUPAC name is 2,3-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 53363554 |
| Molecular Formula | C40H54O2 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | 2,3-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC1=C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C40H54O2/c1-29(2)15-11-17-31(5)19-13-21-33(7)25-27-37-38(40(42)36-24-10-9-23-35(36)39(37)41)28-26-34(8)22-14-20-32(6)18-12-16-30(3)4/h9-10,15-16,19-20,23-26H,11-14,17-18,21-22,27-28H2,1-8H3/b31-19+,32-20+,33-25+,34-26+ |
| InChIKey | FSEGDFKOMAEQPA-MXEIKTMHSA-N |
| XLogP | 11.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|