C27H28O3 — CID 177451046
2-[(2E,6E)-3,7-dimethyl-8-phenoxyocta-2,6-dienyl]-3-methylnaphthalene-1,4-dione (PubChem CID 177451046) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7-dimethyl-8-phenoxyocta-2,6-dienyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[(2E,6E)-3,7-dimethyl-8-phenoxyocta-2,6-dienyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 177451046 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[(2E,6E)-3,7-dimethyl-8-phenoxyocta-2,6-dienyl]-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\C)CC/C=C(\C)COc2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H28O3/c1-19(10-9-11-20(2)18-30-22-12-5-4-6-13-22)16-17-23-21(3)26(28)24-14-7-8-15-25(24)27(23)29/h4-8,11-16H,9-10,17-18H2,1-3H3/b19-16+,20-11+ |
| InChIKey | XFXAUFOAHYRWNQ-OKZVYFILSA-N |
| XLogP | 6.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|