C39H56O6 — CID 67947642
(2Z,6E,10E,14E,18E,22E)-24-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18,22-hexaenoic acid (PubChem CID 67947642) has the molecular formula C39H56O6 and a molecular weight of 620.87 g/mol. Its IUPAC name is (2Z,6E,10E,14E,18E,22E)-24-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18,22-hexaenoic acid.
| Compound Name | (2Z,6E,10E,14E,18E,22E)-24-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18,22-hexaenoic acid |
|---|---|
| PubChem CID | 67947642 |
| Molecular Formula | C39H56O6 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | (2Z,6E,10E,14E,18E,22E)-24-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18,22-hexaenoic acid |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(/C)C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C39H56O6/c1-27(15-10-16-28(2)19-12-20-30(4)23-14-24-32(6)39(42)43)17-11-18-29(3)21-13-22-31(5)25-26-34-33(7)35(40)37(44-8)38(45-9)36(34)41/h16-17,20-21,24-25H,10-15,18-19,22-23,26H2,1-9H3,(H,42,43)/b27-17+,28-16+,29-21+,30-20+,31-25+,32-24- |
| InChIKey | ADOQIUSNTDMVEC-YNXRRPQTSA-N |
| XLogP | 10.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|