C22H32O6 — CID 163002350
12-(2,3-dihydroxy-5-methoxy-6-oxocyclohexen-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid (PubChem CID 163002350) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 12-(2,3-dihydroxy-5-methoxy-6-oxocyclohexen-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid.
| Compound Name | 12-(2,3-dihydroxy-5-methoxy-6-oxocyclohexen-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid |
|---|---|
| PubChem CID | 163002350 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 12-(2,3-dihydroxy-5-methoxy-6-oxocyclohexen-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid |
| SMILES | COC1CC(O)C(O)=C(CC=C(C)CCC=C(C)CCC=C(C)C(=O)O)C1=O |
| InChI | InChI=1S/C22H32O6/c1-14(9-6-10-16(3)22(26)27)7-5-8-15(2)11-12-17-20(24)18(23)13-19(28-4)21(17)25/h7,10-11,18-19,23-24H,5-6,8-9,12-13H2,1-4H3,(H,26,27) |
| InChIKey | SNQNGOWFRZYHQG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|