C18H19NO6 — CID 132599517
(2E,6E)-8-(4,6-dihydroxy-1,3-dioxoisoindol-5-yl)-2,6-dimethylocta-2,6-dienoic acid (PubChem CID 132599517) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (2E,6E)-8-(4,6-dihydroxy-1,3-dioxoisoindol-5-yl)-2,6-dimethylocta-2,6-dienoic acid.
| Compound Name | (2E,6E)-8-(4,6-dihydroxy-1,3-dioxoisoindol-5-yl)-2,6-dimethylocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 132599517 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2E,6E)-8-(4,6-dihydroxy-1,3-dioxoisoindol-5-yl)-2,6-dimethylocta-2,6-dienoic acid |
| SMILES | C/C(=C\Cc1c(O)cc2c(c1O)C(=O)NC2=O)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C18H19NO6/c1-9(4-3-5-10(2)18(24)25)6-7-11-13(20)8-12-14(15(11)21)17(23)19-16(12)22/h5-6,8,20-21H,3-4,7H2,1-2H3,(H,24,25)(H,19,22,23)/b9-6+,10-5+ |
| InChIKey | UCVWIZICIZWNPQ-TXFIJWAUSA-N |
| XLogP | 2.28 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|