C27H34O4 — CID 11825998
5-[2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,5-dihydroxyphenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol (PubChem CID 11825998) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-[2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,5-dihydroxyphenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol.
| Compound Name | 5-[2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,5-dihydroxyphenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 11825998 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 5-[2-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,5-dihydroxyphenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES | CC(C)=CCC/C(C)=C\Cc1cc(O)c(O)cc1-c1cc(O)c(CC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C27H34O4/c1-17(2)7-6-8-19(5)10-11-20-13-26(30)27(31)16-23(20)21-14-24(28)22(25(29)15-21)12-9-18(3)4/h7,9-10,13-16,28-31H,6,8,11-12H2,1-5H3/b19-10- |
| InChIKey | UXVUTAYGHIXRNS-GRSHGNNSSA-N |
| XLogP | 6.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|