C20H24O2 — CID 56928124
2-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-diol (PubChem CID 56928124) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-diol.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 56928124 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-1,4-diol |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H24O2/c1-14(2)7-6-8-15(3)11-12-16-13-19(21)17-9-4-5-10-18(17)20(16)22/h4-5,7,9-11,13,21-22H,6,8,12H2,1-3H3/b15-11+ |
| InChIKey | WASWRHBQWJCLSQ-RVDMUPIBSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|