C46H66O2 — CID 162975214
2-(3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl)-4-methoxynaphthalen-1-ol (PubChem CID 162975214) has the molecular formula C46H66O2 and a molecular weight of 651.03 g/mol. Its IUPAC name is 2-(3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl)-4-methoxynaphthalen-1-ol.
| Compound Name | 2-(3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl)-4-methoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 162975214 |
| Molecular Formula | C46H66O2 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.51 |
| IUPAC Name | 2-(3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl)-4-methoxynaphthalen-1-ol |
| SMILES | COc1cc(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)c(O)c2ccccc12 |
| InChI | InChI=1S/C46H66O2/c1-35(2)18-12-19-36(3)20-13-21-37(4)22-14-23-38(5)24-15-25-39(6)26-16-27-40(7)28-17-29-41(8)32-33-42-34-45(48-9)43-30-10-11-31-44(43)46(42)47/h10-11,18,20,22,24,26,28,30-32,34,47H,12-17,19,21,23,25,27,29,33H2,1-9H3 |
| InChIKey | RRELZXNTKGBBTR-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|