C40H50O3 — CID 139711952
4,5-bis(phenylmethoxy)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenol (PubChem CID 139711952) has the molecular formula C40H50O3 and a molecular weight of 578.84 g/mol. Its IUPAC name is 4,5-bis(phenylmethoxy)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenol.
| Compound Name | 4,5-bis(phenylmethoxy)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenol |
|---|---|
| PubChem CID | 139711952 |
| Molecular Formula | C40H50O3 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | 4,5-bis(phenylmethoxy)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCc1cc(OCc2ccccc2)c(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C40H50O3/c1-31(2)15-12-16-32(3)17-13-18-33(4)19-14-20-34(5)25-26-37-27-39(42-29-35-21-8-6-9-22-35)40(28-38(37)41)43-30-36-23-10-7-11-24-36/h6-11,15,17,19,21-25,27-28,41H,12-14,16,18,20,26,29-30H2,1-5H3 |
| InChIKey | CGGLASFJGUDLOC-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|