C29H40O — CID 158229951
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-5-pentyl-3-phenylmethoxybenzene (PubChem CID 158229951) has the molecular formula C29H40O and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-5-pentyl-3-phenylmethoxybenzene.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-5-pentyl-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 158229951 |
| Molecular Formula | C29H40O |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-5-pentyl-3-phenylmethoxybenzene |
| SMILES | CCCCCc1cc(C)c(C/C=C(\C)CCC=C(C)C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H40O/c1-6-7-9-17-27-20-25(5)28(19-18-24(4)14-12-13-23(2)3)29(21-27)30-22-26-15-10-8-11-16-26/h8,10-11,13,15-16,18,20-21H,6-7,9,12,14,17,19,22H2,1-5H3/b24-18+ |
| InChIKey | GEGINKIDOQDMIK-HKOYGPOVSA-N |
| XLogP | 8.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|