C26H39NO5 — CID 170609109
ethyl 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-pentylphenoxy]carbonylamino]acetate (PubChem CID 170609109) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is ethyl 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-pentylphenoxy]carbonylamino]acetate.
| Compound Name | ethyl 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-pentylphenoxy]carbonylamino]acetate |
|---|---|
| PubChem CID | 170609109 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | ethyl 2-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-pentylphenoxy]carbonylamino]acetate |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(OC(=O)NCC(=O)OCC)c1 |
| InChI | InChI=1S/C26H39NO5/c1-6-8-9-13-21-16-23(28)22(15-14-20(5)12-10-11-19(3)4)24(17-21)32-26(30)27-18-25(29)31-7-2/h11,14,16-17,28H,6-10,12-13,15,18H2,1-5H3,(H,27,30)/b20-14+ |
| InChIKey | CMABKQKGIJZASZ-XSFVSMFZSA-N |
| XLogP | 6.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|