C24H36O4 — CID 156751543
[2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenoxy]methyl acetate (PubChem CID 156751543) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenoxy]methyl acetate.
| Compound Name | [2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenoxy]methyl acetate |
|---|---|
| PubChem CID | 156751543 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenoxy]methyl acetate |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(OCOC(C)=O)c1 |
| InChI | InChI=1S/C24H36O4/c1-6-7-8-12-21-15-23(26)22(24(16-21)28-17-27-20(5)25)14-13-19(4)11-9-10-18(2)3/h10,13,15-16,26H,6-9,11-12,14,17H2,1-5H3 |
| InChIKey | RNHYVSKRTWUUOC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|