C41H49NO5 — CID 175791997
3-O-[2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenyl] 1-O-(9H-fluoren-9-ylmethyl) pyrrolidine-1,3-dicarboxylate (PubChem CID 175791997) has the molecular formula C41H49NO5 and a molecular weight of 635.85 g/mol. Its IUPAC name is 3-O-[2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenyl] 1-O-(9H-fluoren-9-ylmethyl) pyrrolidine-1,3-dicarboxylate.
| Compound Name | 3-O-[2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenyl] 1-O-(9H-fluoren-9-ylmethyl) pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175791997 |
| Molecular Formula | C41H49NO5 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.36 |
| IUPAC Name | 3-O-[2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylphenyl] 1-O-(9H-fluoren-9-ylmethyl) pyrrolidine-1,3-dicarboxylate |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(OC(=O)C2CCN(C(=O)OCC3c4ccccc4-c4ccccc43)C2)c1 |
| InChI | InChI=1S/C41H49NO5/c1-5-6-7-15-30-24-38(43)36(21-20-29(4)14-12-13-28(2)3)39(25-30)47-40(44)31-22-23-42(26-31)41(45)46-27-37-34-18-10-8-16-32(34)33-17-9-11-19-35(33)37/h8-11,13,16-20,24-25,31,37,43H,5-7,12,14-15,21-23,26-27H2,1-4H3 |
| InChIKey | BNPFIEPPAFASLZ-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|