C27H40O6 — CID 156751518
[3-(acetyloxymethoxy)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylphenoxy]methyl acetate (PubChem CID 156751518) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is [3-(acetyloxymethoxy)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylphenoxy]methyl acetate.
| Compound Name | [3-(acetyloxymethoxy)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylphenoxy]methyl acetate |
|---|---|
| PubChem CID | 156751518 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [3-(acetyloxymethoxy)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylphenoxy]methyl acetate |
| SMILES | CCCCCc1cc(OCOC(C)=O)c(CC=C(C)CCC=C(C)C)c(OCOC(C)=O)c1 |
| InChI | InChI=1S/C27H40O6/c1-7-8-9-13-24-16-26(32-18-30-22(5)28)25(27(17-24)33-19-31-23(6)29)15-14-21(4)12-10-11-20(2)3/h11,14,16-17H,7-10,12-13,15,18-19H2,1-6H3 |
| InChIKey | ABVJZXSXRZPPQQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|