C22H34O3 — CID 142209158
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-2-(methoxymethoxy)-5-propylbenzene (PubChem CID 142209158) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-2-(methoxymethoxy)-5-propylbenzene.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-2-(methoxymethoxy)-5-propylbenzene |
|---|---|
| PubChem CID | 142209158 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-2-(methoxymethoxy)-5-propylbenzene |
| SMILES | CCCc1cc(C/C=C(\C)CCC=C(C)C)c(OCOC)c(OC)c1 |
| InChI | InChI=1S/C22H34O3/c1-7-9-19-14-20(13-12-18(4)11-8-10-17(2)3)22(25-16-23-5)21(15-19)24-6/h10,12,14-15H,7-9,11,13,16H2,1-6H3/b18-12+ |
| InChIKey | GQFJRLCPKZZSOL-LDADJPATSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|