C27H40O2 — CID 90362259
1-(methoxymethoxy)-4-methyl-2-prop-2-enyl-5-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene (PubChem CID 90362259) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-(methoxymethoxy)-4-methyl-2-prop-2-enyl-5-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene.
| Compound Name | 1-(methoxymethoxy)-4-methyl-2-prop-2-enyl-5-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
|---|---|
| PubChem CID | 90362259 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-(methoxymethoxy)-4-methyl-2-prop-2-enyl-5-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
| SMILES | C=CCc1cc(C)c(C/C=C(/C)CC/C=C(\C)CCC=C(C)C)cc1OCOC |
| InChI | InChI=1S/C27H40O2/c1-8-11-26-18-24(6)25(19-27(26)29-20-28-7)17-16-23(5)15-10-14-22(4)13-9-12-21(2)3/h8,12,14,16,18-19H,1,9-11,13,15,17,20H2,2-7H3/b22-14+,23-16- |
| InChIKey | JAWQJZJCLVLNFZ-KVVAIAMGSA-N |
| XLogP | 7.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|