C26H37F3O7S — CID 66575383
[3,5-bis(methoxymethoxy)-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl] trifluoromethanesulfonate (PubChem CID 66575383) has the molecular formula C26H37F3O7S and a molecular weight of 550.64 g/mol. Its IUPAC name is [3,5-bis(methoxymethoxy)-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-bis(methoxymethoxy)-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 66575383 |
| Molecular Formula | C26H37F3O7S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [3,5-bis(methoxymethoxy)-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OS(=O)(=O)C(F)(F)F)cc(OCOC)c1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H37F3O7S/c1-19(2)9-7-10-20(3)11-8-12-21(4)13-14-23-24(34-17-32-5)15-22(16-25(23)35-18-33-6)36-37(30,31)26(27,28)29/h9,11,13,15-16H,7-8,10,12,14,17-18H2,1-6H3/b20-11+,21-13+ |
| InChIKey | WWTIRDWEAZRRAZ-VZLKJUJQSA-N |
| XLogP | 6.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|