C28H35NO6 — CID 68976094
2-(3,7-dimethylocta-2,6-dienyl)-1,3-bis(methoxymethoxy)-5-[2-(4-nitrophenyl)ethenyl]benzene (PubChem CID 68976094) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-1,3-bis(methoxymethoxy)-5-[2-(4-nitrophenyl)ethenyl]benzene.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-1,3-bis(methoxymethoxy)-5-[2-(4-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 68976094 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-1,3-bis(methoxymethoxy)-5-[2-(4-nitrophenyl)ethenyl]benzene |
| SMILES | COCOc1cc(C=Cc2ccc([N+](=O)[O-])cc2)cc(OCOC)c1CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C28H35NO6/c1-21(2)7-6-8-22(3)9-16-26-27(34-19-32-4)17-24(18-28(26)35-20-33-5)11-10-23-12-14-25(15-13-23)29(30)31/h7,9-15,17-18H,6,8,16,19-20H2,1-5H3 |
| InChIKey | KRKWQINIYJZTPN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|