C21H30O3 — CID 174472780
3-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethoxyphenyl]prop-2-en-1-ol (PubChem CID 174472780) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethoxyphenyl]prop-2-en-1-ol.
| Compound Name | 3-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethoxyphenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 174472780 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dimethoxyphenyl]prop-2-en-1-ol |
| SMILES | COc1cc(C=CCO)cc(OC)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H30O3/c1-16(2)8-6-9-17(3)11-12-19-20(23-4)14-18(10-7-13-22)15-21(19)24-5/h7-8,10-11,14-15,22H,6,9,12-13H2,1-5H3/b10-7?,17-11+ |
| InChIKey | KVHICOXKUMBFDY-ZAWBFDPHSA-N |
| XLogP | 4.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|