C28H40O4 — CID 71509048
3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4-methoxybenzoic acid (PubChem CID 71509048) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4-methoxybenzoic acid.
| Compound Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 71509048 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4-methoxybenzoic acid |
| SMILES | COc1cc(C/C=C(\C)CCC=C(C)C)c(C(=O)O)c(O)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H40O4/c1-19(2)10-8-12-21(5)14-16-23-18-25(32-7)24(27(29)26(23)28(30)31)17-15-22(6)13-9-11-20(3)4/h10-11,14-15,18,29H,8-9,12-13,16-17H2,1-7H3,(H,30,31)/b21-14+,22-15+ |
| InChIKey | KQDYHKXCCKTDET-NNFYUIBOSA-N |
| XLogP | 7.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|