C24H38O4 — CID 142469217
ethane;2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid (PubChem CID 142469217) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is ethane;2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid.
| Compound Name | ethane;2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 142469217 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | ethane;2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(Z)-3-methylidenehex-4-enyl]benzoic acid |
| SMILES | C=C(/C=C\C)CCc1cc(OC)c(CC=C(C)C)c(O)c1C(=O)O.CC.CC |
| InChI | InChI=1S/C20H26O4.2C2H6/c1-6-7-14(4)9-10-15-12-17(24-5)16(11-8-13(2)3)19(21)18(15)20(22)23;2*1-2/h6-8,12,21H,4,9-11H2,1-3,5H3,(H,22,23);2*1-2H3/b7-6-;; |
| InChIKey | OXWNQKDFTZPURY-AQTVDGORSA-N |
| XLogP | 6.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|