C29H30O5 — CID 171342319
6-[2-[3-(4-ethylphenyl)phenyl]-2-oxoethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid (PubChem CID 171342319) has the molecular formula C29H30O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is 6-[2-[3-(4-ethylphenyl)phenyl]-2-oxoethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid.
| Compound Name | 6-[2-[3-(4-ethylphenyl)phenyl]-2-oxoethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid |
|---|---|
| PubChem CID | 171342319 |
| Molecular Formula | C29H30O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6-[2-[3-(4-ethylphenyl)phenyl]-2-oxoethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid |
| SMILES | CCc1ccc(-c2cccc(C(=O)Cc3cc(OC)c(CC=C(C)C)c(O)c3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H30O5/c1-5-19-10-12-20(13-11-19)21-7-6-8-22(15-21)25(30)16-23-17-26(34-4)24(14-9-18(2)3)28(31)27(23)29(32)33/h6-13,15,17,31H,5,14,16H2,1-4H3,(H,32,33) |
| InChIKey | RJHAKMYDQQWIDU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|