C21H23ClO4S — CID 156779976
methyl 6-[(3-chlorophenyl)sulfanylmethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate (PubChem CID 156779976) has the molecular formula C21H23ClO4S and a molecular weight of 406.93 g/mol. Its IUPAC name is methyl 6-[(3-chlorophenyl)sulfanylmethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate.
| Compound Name | methyl 6-[(3-chlorophenyl)sulfanylmethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| PubChem CID | 156779976 |
| Molecular Formula | C21H23ClO4S |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl 6-[(3-chlorophenyl)sulfanylmethyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate |
| SMILES | COC(=O)c1c(CSc2cccc(Cl)c2)cc(OC)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C21H23ClO4S/c1-13(2)8-9-17-18(25-3)10-14(19(20(17)23)21(24)26-4)12-27-16-7-5-6-15(22)11-16/h5-8,10-11,23H,9,12H2,1-4H3 |
| InChIKey | RGORDERWSMUCEX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|