C23H23F3O4 — CID 122183163
methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 122183163) has the molecular formula C23H23F3O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 122183163 |
| Molecular Formula | C23H23F3O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(/C=C/c2ccc(C(F)(F)F)cc2)cc(OC)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C23H23F3O4/c1-14(2)5-12-18-19(29-3)13-16(20(21(18)27)22(28)30-4)9-6-15-7-10-17(11-8-15)23(24,25)26/h5-11,13,27H,12H2,1-4H3/b9-6+ |
| InChIKey | UPYJDHOYTVQONH-RMKNXTFCSA-N |
| XLogP | 5.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|