C26H27F3O4 — CID 163207572
methyl 4-(cyclopropylmethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 163207572) has the molecular formula C26H27F3O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is methyl 4-(cyclopropylmethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-(cyclopropylmethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 163207572 |
| Molecular Formula | C26H27F3O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | methyl 4-(cyclopropylmethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(/C=C/c2ccc(C(F)(F)F)cc2)cc(OCC2CC2)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C26H27F3O4/c1-16(2)4-13-21-22(33-15-18-5-6-18)14-19(23(24(21)30)25(31)32-3)10-7-17-8-11-20(12-9-17)26(27,28)29/h4,7-12,14,18,30H,5-6,13,15H2,1-3H3/b10-7+ |
| InChIKey | MOZMJVPWDKOCFT-JXMROGBWSA-N |
| XLogP | 6.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|