C25H24F6O4 — CID 175207102
2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid (PubChem CID 175207102) has the molecular formula C25H24F6O4 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid.
| Compound Name | 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 175207102 |
| Molecular Formula | C25H24F6O4 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
| SMILES | CC(C)=CCc1c(OCCCC(F)(F)F)cc(C=Cc2ccc(C(F)(F)F)cc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C25H24F6O4/c1-15(2)4-11-19-20(35-13-3-12-24(26,27)28)14-17(21(22(19)32)23(33)34)8-5-16-6-9-18(10-7-16)25(29,30)31/h4-10,14,32H,3,11-13H2,1-2H3,(H,33,34) |
| InChIKey | HOCHJHCUJNPFSI-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|